DL-trans-Cyclopropane-1,2,3-tricarboxylicacidtrimethylester structure
|
Common Name | DL-trans-Cyclopropane-1,2,3-tricarboxylicacidtrimethylester | ||
|---|---|---|---|---|
| CAS Number | 717-69-1 | Molecular Weight | 216.18800 | |
| Density | 1.301g/cm3 | Boiling Point | 278.5ºC at 760 mmHg | |
| Molecular Formula | C9H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119ºC | |
| Name | trimethyl cyclopropane-1,2,3-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 278.5ºC at 760 mmHg |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.18800 |
| Flash Point | 119ºC |
| Exact Mass | 216.06300 |
| PSA | 78.90000 |
| Index of Refraction | 1.474 |
| InChIKey | MXSHXNGWYJQIBM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C(C(=O)OC)C1C(=O)OC |
| HS Code | 2917209090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| trans-cyclopropane-1,2,3-tricarboxylic acid trimethyl ester |
| DL-trans-Cyclopropane-1,2,3-tricarboxylic acid |
| DL-trans-Cyclopropane-1,2,3-tricarboxylic acid methyl ester |
| Cyclopropane-1,2,3-tricarboxylic acid trimethyl ester |