J 2645 structure
|
Common Name | J 2645 | ||
|---|---|---|---|---|
| CAS Number | 71712-05-5 | Molecular Weight | 326.47200 | |
| Density | 1.005g/cm3 | Boiling Point | 398.8ºC at 760 mmHg | |
| Molecular Formula | C22H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.8ºC | |
| Name | 2,6-ditert-butyl-4-[(4-methoxyphenyl)methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.005g/cm3 |
|---|---|
| Boiling Point | 398.8ºC at 760 mmHg |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.47200 |
| Flash Point | 122.8ºC |
| Exact Mass | 326.22500 |
| PSA | 29.46000 |
| LogP | 5.58660 |
| Index of Refraction | 1.533 |
| InChIKey | ZSAFCPRRUUQDTN-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
|
~%
J 2645 CAS#:71712-05-5 |
| Literature: The United States of America as represented by the Secretary of Agriculture Patent: US4342777 A1, 1982 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,6-Di-tert-butyl-4-<(4-methoxyphenyl)methyl>phenol |
| 2,6-di-t-butyl-4-(4-methoxybenzyl) phenol |