1-phenyl-3-phenylsulfanyl-pyrrolidine-2,5-dione structure
|
Common Name | 1-phenyl-3-phenylsulfanyl-pyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 71724-33-9 | Molecular Weight | 283.34500 | |
| Density | 1.33g/cm3 | Boiling Point | 531.5ºC at 760 mmHg | |
| Molecular Formula | C16H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.3ºC | |
| Name | 1-phenyl-3-phenylsulfanylpyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 531.5ºC at 760 mmHg |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.34500 |
| Flash Point | 275.3ºC |
| Exact Mass | 283.06700 |
| PSA | 62.68000 |
| LogP | 3.17580 |
| Index of Refraction | 1.678 |
| InChIKey | FILZZALMJXSZOK-UHFFFAOYSA-N |
| SMILES | O=C1CC(Sc2ccccc2)C(=O)N1c1ccccc1 |
|
~95%
1-phenyl-3-phen... CAS#:71724-33-9 |
| Literature: Jegelka, Markus; Plietker, Bernd Chemistry - A European Journal, 2011 , vol. 17, # 37 p. 10417 - 10430 |
|
~43%
1-phenyl-3-phen... CAS#:71724-33-9 |
| Literature: Brown, Giles A.; Martel, Sarah R.; Wisedale, Richard; Charmant, Jonathan P.H.; Hales, Neil J.; Fishwick, Colin W.G.; Gallagher, Timothy Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 11 p. 1281 - 1289 |
|
~%
1-phenyl-3-phen... CAS#:71724-33-9 |
| Literature: Hoberg, Heinz; Guhl, Dieter Journal of Organometallic Chemistry, 1989 , vol. 375, p. 245 - 258 |
| 1-phenyl-3-(phenylthio)pyrrolidine-2,5-dione |
| 3-Phenyl-mercapto-N-phenyl-succinimid |
| HMS1677A11 |
| N-phenyl-2-(phenylthio)succinimide |
| 1-phenyl-3-phenylsulfanyl-pyrrolidine-2,5-dione |
| N-phenyl-3-phenylthiosuccinimide |