trans-ethyl-2-(3-methoxyphenyl)cyclopropane-1-carboxylate structure
|
Common Name | trans-ethyl-2-(3-methoxyphenyl)cyclopropane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 71778-34-2 | Molecular Weight | 220.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl (1S,2S)-2-(3-methoxyphenyl)cyclopropanecarboxylate |
|---|
| Molecular Formula | C13H16O3 |
|---|---|
| Molecular Weight | 220.26400 |
| Exact Mass | 220.11000 |
| PSA | 35.53000 |
| LogP | 2.36180 |
| InChIKey | PJGRLHKICHVEIJ-NWDGAFQWSA-N |
| SMILES | CCOC(=O)C1CC1c1cccc(OC)c1 |
| Storage condition | 2-8℃ |
|
~89%
trans-ethyl-2-(... CAS#:71778-34-2 |
| Literature: Davi, Michael; Lebel, Helene Chemical Communications, 2008 , # 40 p. 4974 - 4976 |
|
~48%
trans-ethyl-2-(... CAS#:71778-34-2 |
| Literature: Hixson; Franke; Gere; Xing Journal of the American Chemical Society, 1988 , vol. 110, # 11 p. 3601 - 3610 |