4-[4-(2-hydroxy-ethyl)-piperazin-1-yl]-4-oxo-butyric acid structure
|
Common Name | 4-[4-(2-hydroxy-ethyl)-piperazin-1-yl]-4-oxo-butyric acid | ||
|---|---|---|---|---|
| CAS Number | 717904-43-3 | Molecular Weight | 230.26100 | |
| Density | 1.261g/cm3 | Boiling Point | 480.6ºC at 760 mmHg | |
| Molecular Formula | C10H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.5ºC | |
| Name | 4-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 480.6ºC at 760 mmHg |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26100 |
| Flash Point | 244.5ºC |
| Exact Mass | 230.12700 |
| PSA | 81.08000 |
| Index of Refraction | 1.53 |
| InChIKey | NZOSAPDTJDBHFA-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)N1CCN(CCO)CC1 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD04116817 |
| 4-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxo-butyric acid |