Ethyl 2-cyano-2-phenylbutanoate structure
|
Common Name | Ethyl 2-cyano-2-phenylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 718-71-8 | Molecular Weight | 217.264 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 326.6±22.0 °C at 760 mmHg | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.6±9.1 °C | |
| Name | ethyl 2-cyano-2-phenylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 326.6±22.0 °C at 760 mmHg |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.264 |
| Flash Point | 153.6±9.1 °C |
| Exact Mass | 217.110275 |
| PSA | 50.09000 |
| LogP | 3.05 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | VCJAUIYSQAXNGB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)(CC)c1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2926909090 |
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Ethyl 2-cyano-2-phenylbutanoate |
| 2-ethoxycarbonyl-2-phenylbutyronitrile |
| Ethyl cyanoethylphenylacetate |
| ethyl ethylphenylcyanoacetate |
| Benzeneacetic acid, α-cyano-α-ethyl-, ethyl ester |
| Ethyl α-cyano-α-ethylbenzeneacetate |
| ethyl 2-ethyl-2-phenylcyanoacetate |
| Ethylphenylcyano-acetic acid ethyl ester |
| NCX2&R&VO2 |
| Ethyl-2-phenyl-2-cyanobutylate |
| ethyl ester of phenylethylcyanoacetic acid |
| cyano-ethyl-phenyl-acetic acid ethyl ester |