ac1l3pd9 structure
|
Common Name | ac1l3pd9 | ||
|---|---|---|---|---|
| CAS Number | 71925-32-1 | Molecular Weight | 192.21600 | |
| Density | 1.29g/cm3 | Boiling Point | 359ºC at 760 mmHg | |
| Molecular Formula | C13H8N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.1ºC | |
| Name | ac1l3pd9 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 359ºC at 760 mmHg |
| Molecular Formula | C13H8N2 |
| Molecular Weight | 192.21600 |
| Flash Point | 175.1ºC |
| Exact Mass | 192.06900 |
| PSA | 47.58000 |
| LogP | 2.59276 |
| Index of Refraction | 1.655 |
| InChIKey | FKQQTMCKMQUPSN-UHFFFAOYSA-N |
| SMILES | N#CC1=CC2CC1c1cccc(C#N)c12 |
|
~%
ac1l3pd9 CAS#:71925-32-1 |
| Literature: Paquette,L.A. et al. Journal of the American Chemical Society, 1979 , vol. 101, # 20 p. 5972 - 5980 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4-Methanonaphthalene-2,5-dicarbonitrile,1,4-dihydro |
| 2,5-dicyano-benzobicyclo(2.2.1)heptadiene |
| 2,5-Dicyan-benzonorbornadien |