Acetic acid,2,2,2-trichloro-, 2-phenylethyl ester structure
|
Common Name | Acetic acid,2,2,2-trichloro-, 2-phenylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 71965-07-6 | Molecular Weight | 267.53600 | |
| Density | 1.386g/cm3 | Boiling Point | 312.1ºC at 760 mmHg | |
| Molecular Formula | C10H9Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.4ºC | |
| Name | 2-phenylethyl 2,2,2-trichloroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 312.1ºC at 760 mmHg |
| Molecular Formula | C10H9Cl3O2 |
| Molecular Weight | 267.53600 |
| Flash Point | 123.4ºC |
| Exact Mass | 265.96700 |
| PSA | 26.30000 |
| LogP | 3.14250 |
| Index of Refraction | 1.548 |
| InChIKey | ZIOAZUXFQCBCKA-UHFFFAOYSA-N |
| SMILES | O=C(OCCc1ccccc1)C(Cl)(Cl)Cl |
|
~%
Acetic acid,2,2... CAS#:71965-07-6 |
| Literature: Hibbert; Greig Canadian Journal of Research, 1931 , vol. 4, p. 254,260 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| Trichloroacetic acid,2-phenylethyl ester |
| phenethyl 2,2,2-trichloroacetate |
| 2-Trichloracetoxy-1-phenyl-aethan |
| 2-Phenylethyl trichloroacetate |
| trichloro-acetic acid phenethyl ester |
| Trichlor-essigsaeure-phenaethylester |