3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one
3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one structure
|
Common Name | 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one | ||
|---|---|---|---|---|
| CAS Number | 72016-31-0 | Molecular Weight | 220.18200 | |
| Density | 1.684g/cm3 | Boiling Point | 257.4ºC at 760 mmHg | |
| Molecular Formula | C10H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.684g/cm3 |
|---|---|
| Boiling Point | 257.4ºC at 760 mmHg |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18200 |
| Flash Point | 109.5ºC |
| Exact Mass | 220.04800 |
| PSA | 106.18000 |
| LogP | 0.14140 |
| Index of Refraction | 1.739 |
| InChIKey | KGTLLZFATVDCCC-UHFFFAOYSA-N |
| SMILES | O=c1cc[nH]c(-c2[nH]ccc(=O)c2O)c1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 1 | |
CAS#:101664-55-5
CAS#:119767-37-2![3,3'-Bis[[2-(trimethylsilyl)ethoxy]methoxy]-2,2'-bipyridin-4,4'-diol Structure](https://image.chemsrc.com/caspic/487/119767-30-5.png)
CAS#:119767-30-5
CAS#:37338-80-0
CAS#:109-00-2
CAS#:6602-32-0
CAS#:17282-04-1
CAS#:85386-94-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2,2'-Bipyridine)-3,3',4,4'-tetrol |
| 3,3'-dihydroxy-1H,1'H-[2,2']bipyridinyl-4,4'-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one? |
| A: Molecular weight of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one is 220.18200. |
| Q: What is the SMILES notation of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one? |
| A: SMILES notation of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one is O=c1cc[nH]c(-c2[nH]ccc(=O)c2O)c1O. |
| Q: What is the InChIKey of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one? |
| A: InChIKey of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one is KGTLLZFATVDCCC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 72016-31-0? |
| A: Chinese name of 72016-31-0 is 72016-31-0. |
| Q: What is the LogP of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one? |
| A: LogP of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one is 0.14140. |
| Q: What is the molecular formula of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one? |
| A: Molecular formula of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one is C10H8N2O4. |
| Q: What is the English name of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one? |
| A: The English name of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one is 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one. |
| Q: What is the CAS number of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one? |
| A: CAS number of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one is 72016-31-0. |
| Q: What are the downstream products of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one? |
| A: Related downstream products(CAS) of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one: 37338-80-0. |
| Q: What English synonyms does 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one have? |
| A: English synonyms of 3-hydroxy-2-(3-hydroxy-4-oxo-1H-pyridin-2-yl)-1H-pyridin-4-one: (2,2'-Bipyridine)-3,3',4,4'-tetrol, 3,3'-dihydroxy-1H,1'H-[2,2']bipyridinyl-4,4'-dione. |