Henryoside structure
|
Common Name | Henryoside | ||
|---|---|---|---|---|
| CAS Number | 72021-23-9 | Molecular Weight | 584.523 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 873.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C26H32O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.5±27.8 °C | |
Use of HenryosideHenryoside, an acylated salicin bis-glucoside from Viburnum veitchii, exhibits spasmolytic and uterotonic properties[1]. |
| Name | 2-(β-D-Glucopyranosyloxy)benzyl 2-(β-D-glucopyranosyloxy)-6-hydro xybenzoate |
|---|---|
| Synonym | More Synonyms |
| Description | Henryoside, an acylated salicin bis-glucoside from Viburnum veitchii, exhibits spasmolytic and uterotonic properties[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 873.3±65.0 °C at 760 mmHg |
| Molecular Formula | C26H32O15 |
| Molecular Weight | 584.523 |
| Flash Point | 289.5±27.8 °C |
| Exact Mass | 584.174133 |
| PSA | 245.29000 |
| LogP | -1.78 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | BHHRYVYZZQIPGU-NXEOTYAVSA-N |
| SMILES | O=C(OCc1ccccc1OC1OC(CO)C(O)C(O)C1O)c1c(O)cccc1OC1OC(CO)C(O)C(O)C1O |
| Hazard Codes | Xi |
|---|
| 2-(β-D-Glucopyranosyloxy)benzyl 2-(β-D-glucopyranosyloxy)-6-hydroxybenzoate |
| Benzoic acid, 2-(β-D-glucopyranosyloxy)-6-hydroxy-, [2-(β-D-glucopyranosyloxy)phenyl]methyl ester |