3-(4-chlorophenyl)-2-(4-methoxyphenyl)prop-2-enenitrile structure
|
Common Name | 3-(4-chlorophenyl)-2-(4-methoxyphenyl)prop-2-enenitrile | ||
|---|---|---|---|---|
| CAS Number | 72030-12-7 | Molecular Weight | 269.72600 | |
| Density | 1.215g/cm3 | Boiling Point | 417.4ºC at 760 mmHg | |
| Molecular Formula | C16H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.3ºC | |
| Name | (E)-3-(4-chlorophenyl)-2-(4-methoxyphenyl)prop-2-enenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 417.4ºC at 760 mmHg |
| Molecular Formula | C16H12ClNO |
| Molecular Weight | 269.72600 |
| Flash Point | 206.3ºC |
| Exact Mass | 269.06100 |
| PSA | 33.02000 |
| LogP | 4.41278 |
| Index of Refraction | 1.624 |
| InChIKey | ATCNORQEZFVCAK-UVTDQMKNSA-N |
| SMILES | COc1ccc(C(C#N)=Cc2ccc(Cl)cc2)cc1 |
|
~93%
3-(4-chlorophen... CAS#:72030-12-7 |
| Literature: Yue, Youfeng; Fang, Haiyan; Wang, Meijun; Wang, Zhiyuan; Yu, Mingxin Journal of Chemical Research, 2009 , # 6 p. 377 - 380 |
|
~%
3-(4-chlorophen... CAS#:72030-12-7 |
| Literature: Buu-Hoi; Xuong Bulletin de la Societe Chimique de France, 1957 , p. 650,652 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2E)-3-(4-chlorophenyl)-2-(4-methoxyphenyl)prop-2-enenitrile |
| (Z)-3-(4-chlorophenyl)-2-(4-methoxyphenyl)acrylonitrile |