Uridine,2'-deoxy-5-[(1E)-2-(3-nitrophenyl)ethenyl]- (9CI) structure
|
Common Name | Uridine,2'-deoxy-5-[(1E)-2-(3-nitrophenyl)ethenyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 72045-16-0 | Molecular Weight | 375.33300 | |
| Density | 1.585g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H17N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(E)-2-(3-nitrophenyl)ethenyl]pyrimidine-2,4-dione |
|---|
| Density | 1.585g/cm3 |
|---|---|
| Molecular Formula | C17H17N3O7 |
| Molecular Weight | 375.33300 |
| Exact Mass | 375.10700 |
| PSA | 150.37000 |
| LogP | 0.77910 |
| Index of Refraction | 1.734 |
| InChIKey | ZJTGMOBMIWLDJM-SNAWJCMRSA-N |
| SMILES | O=c1[nH]c(=O)n(C2CC(O)C(CO)O2)cc1C=Cc1cccc([N+](=O)[O-])c1 |
|
~50%
Uridine,2'-deox... CAS#:72045-16-0 |
| Literature: Bigge,C.F.; Kalaritis,P.; Deck,J.R. Journal of the American Chemical Society, 1980 , vol. 102, p. 2033 |
|
~%
Uridine,2'-deox... CAS#:72045-16-0 |
| Literature: Bigge,C.F.; Kalaritis,P.; Deck,J.R. Journal of the American Chemical Society, 1980 , vol. 102, p. 2033 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |