3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid
3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid structure
|
Common Name | 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 720698-91-9 | Molecular Weight | 231.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17NO2 |
|---|---|
| Molecular Weight | 231.29000 |
| Exact Mass | 231.12600 |
| PSA | 40.54000 |
| LogP | 2.18830 |
| InChIKey | FUNOCOFRUROSPL-UHFFFAOYSA-N |
| SMILES | O=C(O)CCN1CC=C(c2ccccc2)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-(4-phenyl-3,6... CAS#:720698-91-9 |
| Literature: NEUROCHEM (INTERNATIONAL) LIMITED Patent: WO2004/113275 A2, 2004 ; Location in patent: Page 169; 170 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(4-phenyl-1,2,3,6-tetrahydropyridin-1-yl) propanoic acid |
| 1(2H)-Pyridinepropanoic acid,3,6-dihydro-4-phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid? |
| A: CAS number of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid is 720698-91-9. |
| Q: What is the English name of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid? |
| A: The English name of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid is 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid. |
| Q: What English synonyms does 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid have? |
| A: English synonyms of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid: 3-(4-phenyl-1,2,3,6-tetrahydropyridin-1-yl) propanoic acid, 1(2H)-Pyridinepropanoic acid,3,6-dihydro-4-phenyl. |
| Q: What is the molecular weight of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid? |
| A: Molecular weight of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid is 231.29000. |
| Q: What is the InChIKey of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid? |
| A: InChIKey of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid is FUNOCOFRUROSPL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid? |
| A: Molecular formula of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid is C14H17NO2. |
| Q: What is the SMILES notation of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid? |
| A: SMILES notation of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid is O=C(O)CCN1CC=C(c2ccccc2)CC1. |
| Q: What is the polar surface area (PSA) of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid? |
| A: Polar surface area (PSA) of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid is 40.54000. |
| Q: What are the upstream materials of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid? |
| A: Related upstream materials(CAS) of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid: 3395-91-3;43064-12-6. |
| Q: What is the LogP of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid? |
| A: LogP of 3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propanoic acid is 2.18830. |