Mastoparan X
Modify Date: 2026-07-04 08:58:41
Mastoparan X structure
|
Common Name | Mastoparan X | ||
|---|---|---|---|---|
| CAS Number | 72093-22-2 | Molecular Weight | 1555.97000 | |
| Density | 1.207 g/cm3 | Boiling Point | 1797.4ºC at 760 mmHg | |
| Molecular Formula | C73H126N20O15S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1040.8ºC | |
Use of Mastoparan XMastoparan X is a GTP-binding regulatory protein (G protein)-activating peptide, and a tetradecapeptide from wasp venom. Mastoparan X acts function by the direct activation of G protein that couple to phospholipase C to cause secretion from various kinds of cells[1]. |
| Name | Mastoparan X |
|---|---|
| Synonym | More Synonyms |
| Description | Mastoparan X is a GTP-binding regulatory protein (G protein)-activating peptide, and a tetradecapeptide from wasp venom. Mastoparan X acts function by the direct activation of G protein that couple to phospholipase C to cause secretion from various kinds of cells[1]. |
|---|---|
| Related Catalog | |
| Target |
GTP-binding regulatory protein (G protein)[1] |
| In Vitro | Mastoparan X (1.5 mM) interacts with phospholipid bicelles, and results the line broadening[2]. Mastoparan X binds to the membrane, and increases the cell’s permeability to cations leading to a disruption in the electrolyte balance and cell lysis[2]. |
| References |
| Density | 1.207 g/cm3 |
|---|---|
| Boiling Point | 1797.4ºC at 760 mmHg |
| Molecular Formula | C73H126N20O15S |
| Molecular Weight | 1555.97000 |
| Flash Point | 1040.8ºC |
| Exact Mass | 1554.94000 |
| PSA | 609.65000 |
| LogP | 6.99990 |
| Index of Refraction | 1.558 |
| InChIKey | FYJKBFOGJAVCAL-UHFFFAOYSA-N |
| SMILES | CCC(C)C(N)C(=O)NC(CC(N)=O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCCN)C(=O)NCC(=O)NC(C(=O)NC(C)C(=O)NC(C)C(=O)NC(CCSC)C(=O)NC(C)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(N)=O)C(C)CC |
| Safety Phrases | 22-24/25 |
|---|
|
~%
Mastoparan X CAS#:72093-22-2 |
| Literature: Yajima; Kanaki; Funakoshi; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 3 p. 882 - 886 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| DL-AP5 Sodium salt |
| H-ILE-ASN-TRP-LYS-GLY-ILE-ALA-ALA-MET-ALA-LYS-LYS-LEU-LEU-NH2 |
| INWKGIAAMAKKLL-NH2 |
| Ile-Asn-Trp-Lys-Gly-Ile-Ala-Ala-Met-Ala-Lys-Lys-Leu-Leu-NH2 |