4-(2,2,3,3-tetrafluoropropoxy)benzoic acid
Modify Date: 2025-11-13 22:49:49
4-(2,2,3,3-tetrafluoropropoxy)benzoic acid structure
|
Common Name | 4-(2,2,3,3-tetrafluoropropoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 72106-04-8 | Molecular Weight | 252.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8F4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2,2,3,3-tetrafluoropropoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8F4O3 |
|---|---|
| Molecular Weight | 252.16200 |
| Exact Mass | 252.04100 |
| PSA | 46.53000 |
| LogP | 2.66400 |
| InChIKey | TZPDZECSXKPAGD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OCC(F)(F)C(F)F)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(1,1,3-trihydroperfluoropropoxy)benzoic acid |