3,5-bis(trifluoromethyl)benzamidoxime structure
|
Common Name | 3,5-bis(trifluoromethyl)benzamidoxime | ||
|---|---|---|---|---|
| CAS Number | 72111-09-2 | Molecular Weight | 272.147 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 283.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C9H6F6N2O | Melting Point | 129-132 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 125.4±30.1 °C | |
| Name | N'-Hydroxy-3,5-bis(trifluoromethyl)benzimidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 283.8±50.0 °C at 760 mmHg |
| Melting Point | 129-132 °C(lit.) |
| Molecular Formula | C9H6F6N2O |
| Molecular Weight | 272.147 |
| Flash Point | 125.4±30.1 °C |
| Exact Mass | 272.038422 |
| PSA | 58.61000 |
| LogP | 3.54 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | GGAPMNUHESBFNK-UHFFFAOYSA-N |
| SMILES | NC(=NO)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S22-S36/37/39-S45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925290090 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
A novel and specific fluorescence reaction for uracil Shibata, Takayuki, et al.
Anal. Chim. Acta 674.2 , 234-238, (2010)
|
| MFCD00068188 |
| Benzenecarboximidamide, N-hydroxy-3,5-bis(trifluoromethyl)- |
| N-Hydroxy-3,5-bis(trifluoromethyl)benzenecarboximidamide |
| 3,5-bis(trifluoromethyl)benzamidoxime |