5-phenyl-6-(propylamino)pyrazine-2,3-dicarbonitrile structure
|
Common Name | 5-phenyl-6-(propylamino)pyrazine-2,3-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 72113-09-8 | Molecular Weight | 263.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-phenyl-6-(propylamino)pyrazine-2,3-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13N5 |
|---|---|
| Molecular Weight | 263.29700 |
| Exact Mass | 263.11700 |
| PSA | 85.39000 |
| LogP | 2.78186 |
| InChIKey | JKJLYIXMHRHTNY-UHFFFAOYSA-N |
| SMILES | CCCNc1nc(C#N)c(C#N)nc1-c1ccccc1 |
|
~90%
5-phenyl-6-(pro... CAS#:72113-09-8 |
| Literature: Kyowa Gas Chemical Industry Co. Ltd. Patent: US4259489 A1, 1981 ; |
|
~91%
5-phenyl-6-(pro... CAS#:72113-09-8 |
| Literature: Nakamura, Akira; Ataka, Toshiei; Segawa, Hirozo; Tekeuchi, Yasutomo; Takematsu, Tetsuo Agricultural and Biological Chemistry, 1983 , vol. 47, # 7 p. 1561 - 1568 |
|
~%
5-phenyl-6-(pro... CAS#:72113-09-8 |
| Literature: Nakamura, Akira; Ataka, Toshiei; Segawa, Hirozo; Tekeuchi, Yasutomo; Takematsu, Tetsuo Agricultural and Biological Chemistry, 1983 , vol. 47, # 7 p. 1561 - 1568 |
|
~%
5-phenyl-6-(pro... CAS#:72113-09-8 |
| Literature: Nakamura, Akira; Ataka, Toshiei; Segawa, Hirozo; Tekeuchi, Yasutomo; Takematsu, Tetsuo Agricultural and Biological Chemistry, 1983 , vol. 47, # 7 p. 1561 - 1568 |
| 2,3-dicyano-5-n-propylamino-6-phenylpyrazine |
| 6-Phenyl-5-propylamino-2,3-pyrazinedicarbonitrile |
| 2,3-Pyrazinedicarbonitrile,5-phenyl-6-(propylamino) |
| 2,3-Dicyano-5-propylamino-6-phenylpyrazine |
| 5-phenyl-6-propylamino-pyrazine-2,3-dicarbonitrile |