5-(3-chlorophenyl)-6-(propylamino)pyrazine-2,3-dicarbonitrile structure
|
Common Name | 5-(3-chlorophenyl)-6-(propylamino)pyrazine-2,3-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 72113-45-2 | Molecular Weight | 297.74200 | |
| Density | 1.33g/cm3 | Boiling Point | 509ºC at 760 mmHg | |
| Molecular Formula | C15H12ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.6ºC | |
| Name | 5-(3-chlorophenyl)-6-(propylamino)pyrazine-2,3-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 509ºC at 760 mmHg |
| Molecular Formula | C15H12ClN5 |
| Molecular Weight | 297.74200 |
| Flash Point | 261.6ºC |
| Exact Mass | 297.07800 |
| PSA | 85.39000 |
| LogP | 3.43526 |
| Index of Refraction | 1.623 |
| InChIKey | PPGJFOXCUVMTRR-UHFFFAOYSA-N |
| SMILES | CCCNc1nc(C#N)c(C#N)nc1-c1cccc(Cl)c1 |
|
~75%
5-(3-chlorophen... CAS#:72113-45-2 |
| Literature: Kyowa Gas Chemical Industry Co. Ltd. Patent: US4259489 A1, 1981 ; |
|
~92%
5-(3-chlorophen... CAS#:72113-45-2 |
| Literature: Nakamura, Akira; Ataka, Toshiei; Segawa, Hirozo; Tekeuchi, Yasutomo; Takematsu, Tetsuo Agricultural and Biological Chemistry, 1983 , vol. 47, # 7 p. 1561 - 1568 |
|
~%
5-(3-chlorophen... CAS#:72113-45-2 |
| Literature: Nakamura, Akira; Ataka, Toshiei; Segawa, Hirozo; Tekeuchi, Yasutomo; Takematsu, Tetsuo Agricultural and Biological Chemistry, 1983 , vol. 47, # 7 p. 1561 - 1568 |
|
~%
5-(3-chlorophen... CAS#:72113-45-2 |
| Literature: Nakamura, Akira; Ataka, Toshiei; Segawa, Hirozo; Tekeuchi, Yasutomo; Takematsu, Tetsuo Agricultural and Biological Chemistry, 1983 , vol. 47, # 7 p. 1561 - 1568 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,3-dicyano-5-n-propylamino-6-(m-chlorophenyl)pyrazine |
| 2,3-Pyrazinedicarbonitrile,5-(3-chlorophenyl)-6-(propylamino) |
| 5-(3-chloro-phenyl)-6-propylamino-pyrazine-2,3-dicarbonitrile |