isocyanatobenzene,tris(2-chloroethyl) phosphate structure
|
Common Name | isocyanatobenzene,tris(2-chloroethyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 72121-79-0 | Molecular Weight | 404.61100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17Cl3NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | isocyanatobenzene,tris(2-chloroethyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17Cl3NO5P |
|---|---|
| Molecular Weight | 404.61100 |
| Exact Mass | 402.99100 |
| PSA | 84.00000 |
| LogP | 4.51460 |
| InChIKey | NIXFWPBXEGFDRV-UHFFFAOYSA-N |
| SMILES | O=C=Nc1ccccc1.O=P(OCCCl)(OCCCl)OCCCl |
| Ethanol,2-chloro-,1,1',1''-phosphate,polymer with isocyanatobenzene |
| Ethanol,2-chloro-,phosphate (3:1),polymer with isocyanatobenzene |