N-[2-[(Methylamino)carbonyl]benzoyl] structure
|
Common Name | N-[2-[(Methylamino)carbonyl]benzoyl] | ||
|---|---|---|---|---|
| CAS Number | 721958-72-1 | Molecular Weight | 570.033 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 756.8±60.0 °C at 760 mmHg | |
| Molecular Formula | C29H32ClN3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 411.5±32.9 °C | |
Use of N-[2-[(Methylamino)carbonyl]benzoyl]Amlodipine besilate impurity B is a biochemical. |
| Name | 5-O-ethyl 3-O-methyl 4-(2-chlorophenyl)-2-methyl-6-[2-[[2-(methylcarbamoyl)benzoyl]amino]ethoxymethyl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 756.8±60.0 °C at 760 mmHg |
| Molecular Formula | C29H32ClN3O7 |
| Molecular Weight | 570.033 |
| Flash Point | 411.5±32.9 °C |
| Exact Mass | 569.192871 |
| PSA | 139.04000 |
| LogP | 3.77 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | SNNCONCKJDOFKX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(COCCNC(=O)c2ccccc2C(=O)NC)NC(C)=C(C(=O)OC)C1c1ccccc1Cl |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
|
~91%
N-[2-[(Methylam... CAS#:721958-72-1 |
| Literature: EOS ECZACIBASI OZGUN KIMYASAL URUNLER SANAYI VE TICARET A.S. Patent: WO2004/58711 A1, 2004 ; Location in patent: Page 17 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phthalodinitril |
| 3,5-Pyridinedicarboxylic acid, 4-(2-chlorophenyl)-1,4-dihydro-2-methyl-6-[[2-[[2-[(methylamino)carbonyl]benzoyl]amino]ethoxy]methyl]-, 5-ethyl 3-methyl ester |
| 1,2-dicyanobenzene |
| 5-Ethyl 3-methyl 4-(2-chlorophenyl)-2-methyl-6-[(2-{[2-(methylcarbamoyl)benzoyl]amino}ethoxy)methyl]-1,4-dihydro-3,5-pyridinedicarboxylate |
| dicyanobenzene |
| PHTHALICNITRILE |
| o-PDN |
| o-phthalonitrile |
| Ftalodinitril |
| Ftalonitril |
| UNII:436R8SHM18 |
| 1,2-Benzenedicarbonitrile |
| PHTHALODINITRILE |
| phthaloyl amlodipine |
| o-dicyanobenzene |
| N-[2-[(Methylamino)carbonyl]benzoyl] |
| Amlodipine Impurity 2 |