9,10-dioxoanthracene-1-carboxamide
9,10-dioxoanthracene-1-carboxamide structure
|
Common Name | 9,10-dioxoanthracene-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 7223-68-9 | Molecular Weight | 251.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9,10-dioxoanthracene-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H9NO3 |
|---|---|
| Molecular Weight | 251.23700 |
| Exact Mass | 251.05800 |
| PSA | 78.22000 |
| LogP | 2.44510 |
| InChIKey | QNLRSUPDYDUZSS-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cccc2c1C(=O)c1ccccc1C2=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
9,10-dioxoanthr... CAS#:7223-68-9 |
| Literature: Graebe; Blumenfeld Chemische Berichte, 1897 , vol. 30, p. 1115 |
|
~%
9,10-dioxoanthr... CAS#:7223-68-9 |
| Literature: Dienel Chemische Berichte, 1906 , vol. 39, p. 932 |
|
~%
9,10-dioxoanthr... CAS#:7223-68-9 |
| Literature: Dienel Chemische Berichte, 1906 , vol. 39, p. 932 |
|
~%
9,10-dioxoanthr... CAS#:7223-68-9 |
| Literature: Graebe; Blumenfeld Chemische Berichte, 1897 , vol. 30, p. 1115 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 2 | |
CAS#:475-71-8
CAS#:82-45-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Anthracenecarboxamide,9,10-dihydro-9,10-dioxo |
| 9,10-Dioxo-9,10-dihydro-anthracen-1-carbonsaeure-amid |
| Anthrachinon-carbonsaeure-(1)-amid |
| 9.10-Dioxo-9.10-dihydro-anthracen-carbamid-(1) |
| 9,10-dioxo-9,10-dihydro-anthracene-1-carboxylic acid amide |
| anthraquinonylamide |
| Anthrachinon-1-carbonsaeureamid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 9,10-dioxoanthracene-1-carboxamide? |
| A: SMILES notation of 9,10-dioxoanthracene-1-carboxamide is NC(=O)c1cccc2c1C(=O)c1ccccc1C2=O. |
| Q: What is the LogP of 9,10-dioxoanthracene-1-carboxamide? |
| A: LogP of 9,10-dioxoanthracene-1-carboxamide is 2.44510. |
| Q: What is the InChIKey of 9,10-dioxoanthracene-1-carboxamide? |
| A: InChIKey of 9,10-dioxoanthracene-1-carboxamide is QNLRSUPDYDUZSS-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 9,10-dioxoanthracene-1-carboxamide? |
| A: Polar surface area (PSA) of 9,10-dioxoanthracene-1-carboxamide is 78.22000. |
| Q: What are the downstream products of 9,10-dioxoanthracene-1-carboxamide? |
| A: Related downstream products(CAS) of 9,10-dioxoanthracene-1-carboxamide: 475-71-8;82-45-1. |
| Q: What is the molecular weight of 9,10-dioxoanthracene-1-carboxamide? |
| A: Molecular weight of 9,10-dioxoanthracene-1-carboxamide is 251.23700. |
| Q: What is the CAS number of 9,10-dioxoanthracene-1-carboxamide? |
| A: CAS number of 9,10-dioxoanthracene-1-carboxamide is 7223-68-9. |
| Q: What is the molecular formula of 9,10-dioxoanthracene-1-carboxamide? |
| A: Molecular formula of 9,10-dioxoanthracene-1-carboxamide is C15H9NO3. |
| Q: What is the Chinese name of 7223-68-9? |
| A: Chinese name of 7223-68-9 is 7223-68-9. |
| Q: What are the upstream materials of 9,10-dioxoanthracene-1-carboxamide? |
| A: Related upstream materials(CAS) of 9,10-dioxoanthracene-1-carboxamide: 602-69-7;32978-19-1;607-42-1;602-82-4. |