Bis(1,3-dichloro-2-propyl) Phosphate structure
|
Common Name | Bis(1,3-dichloro-2-propyl) Phosphate | ||
|---|---|---|---|---|
| CAS Number | 72236-72-7 | Molecular Weight | 319.93500 | |
| Density | 1.536g/cm3 | Boiling Point | 396.9ºC at 760 mmHg | |
| Molecular Formula | C6H11Cl4O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.8ºC | |
| Name | Bis(1,3-dichloro-2-propanyl) hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.536g/cm3 |
|---|---|
| Boiling Point | 396.9ºC at 760 mmHg |
| Molecular Formula | C6H11Cl4O4P |
| Molecular Weight | 319.93500 |
| Flash Point | 193.8ºC |
| Exact Mass | 317.91500 |
| PSA | 65.57000 |
| LogP | 2.81240 |
| Index of Refraction | 1.498 |
| InChIKey | NNKRUBFJSSBFSS-UHFFFAOYSA-N |
| SMILES | O=P(O)(OC(CCl)CCl)OC(CCl)CCl |
|
~%
Bis(1,3-dichlor... CAS#:72236-72-7 |
| Literature: Markowska,A. et al. Bulletin de l'Academie Polonaise des Sciences, Serie des Sciences Chimiques, 1979 , vol. 27, p. 115 - 119 |
|
~%
Bis(1,3-dichlor... CAS#:72236-72-7 |
| Literature: King; Pyman Journal of the Chemical Society, 1914 , vol. 105, p. 1247 |
| Phosphorsaeure-bis-(2-chlor-aethylester) |
| phosphoric acid bis-(2-chloro-1-chloromethyl-ethyl) ester |
| phosphoric acid bis-(2-chloro-ethyl) ester |
| Bis-(2-chlor-aethyl)-phosphat |
| Bis-(dichlor-isopropyl)-phosphat |
| Ethanol,2-chloro-,hydrogen phosphate |
| Bis(1,3-dichloro-2-propyl) Phosphate |