6H-Pyrido[4,3-b]carbazol-8-ol, 5, 11-dimethyl- structure
|
Common Name | 6H-Pyrido[4,3-b]carbazol-8-ol, 5, 11-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 72236-82-9 | Molecular Weight | 262.30600 | |
| Density | 1.349g/cm3 | Boiling Point | 557.7ºC at 760 mmHg | |
| Molecular Formula | C17H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.1ºC | |
| Name | 5,11-dimethyl-6H-pyrido[4,3-b]carbazol-8-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.349g/cm3 |
|---|---|
| Boiling Point | 557.7ºC at 760 mmHg |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.30600 |
| Flash Point | 291.1ºC |
| Exact Mass | 262.11100 |
| PSA | 48.91000 |
| LogP | 4.19170 |
| Index of Refraction | 1.81 |
| InChIKey | FQWYUADAXYUHGZ-UHFFFAOYSA-N |
| SMILES | Cc1c2ccncc2c(C)c2c1[nH]c1cc(O)ccc12 |
|
~30%
6H-Pyrido[4,3-b... CAS#:72236-82-9 |
| Literature: Sainsbury, Malcolm; Weerasinghe, Deepthi; Dolman, David Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , p. 587 - 590 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 8-hydroxyellipticine |
| 6H-Pyrido(4,3-b)carbazol-8-ol,5,11-dimethyl |
| ELLIPTICINE,8-HYDROXY |
| MC-8-OH |