N-(4-Nitrophenyl)decanamide structure
|
Common Name | N-(4-Nitrophenyl)decanamide | ||
|---|---|---|---|---|
| CAS Number | 72298-63-6 | Molecular Weight | 292.373 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 473.1±28.0 °C at 760 mmHg | |
| Molecular Formula | C16H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.9±24.0 °C | |
| Name | N-(4-nitrophenyl)decanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 473.1±28.0 °C at 760 mmHg |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.373 |
| Flash Point | 239.9±24.0 °C |
| Exact Mass | 292.178680 |
| PSA | 74.92000 |
| LogP | 5.91 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | OYQMGBPTCMSMAD-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
|
~75%
N-(4-Nitropheny... CAS#:72298-63-6 |
| Literature: Kumar, Ashwani; Singh, Surender; Jain, Sandeep; Kumar, Parvin Acta Poloniae Pharmaceutica - Drug Research, 2011 , vol. 68, # 2 p. 191 - 204 |
|
~%
N-(4-Nitropheny... CAS#:72298-63-6 |
| Literature: Kumar, Ashwani; Singh, Surender; Jain, Sandeep; Kumar, Parvin Acta Poloniae Pharmaceutica - Drug Research, 2011 , vol. 68, # 2 p. 191 - 204 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Decanoyl p-Nitroaniline |
| DEPNA |
| Decanoyl-p-nitroanilide |
| N-(4-Nitrophenyl)decanamide |