(4,11,11-trimethyl-8-bicyclo[7.2.0]undec-4-enyl) 4-methylbenzenesulfonate structure
|
Common Name | (4,11,11-trimethyl-8-bicyclo[7.2.0]undec-4-enyl) 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 7233-43-4 | Molecular Weight | 362.52600 | |
| Density | 1.13g/cm3 | Boiling Point | 472.2ºC at 760 mmHg | |
| Molecular Formula | C21H30O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.4ºC | |
| Name | (4,11,11-trimethyl-8-bicyclo[7.2.0]undec-4-enyl) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 472.2ºC at 760 mmHg |
| Molecular Formula | C21H30O3S |
| Molecular Weight | 362.52600 |
| Flash Point | 239.4ºC |
| Exact Mass | 362.19200 |
| PSA | 51.75000 |
| LogP | 6.33230 |
| Index of Refraction | 1.555 |
| InChIKey | BKSAGGSLOVCNEM-UHFFFAOYSA-N |
| SMILES | CC1=CCCC(OS(=O)(=O)c2ccc(C)cc2)C2CC(C)(C)C2CC1 |
|
~%
(4,11,11-trimet... CAS#:7233-43-4 |
| Literature: Morozov; Gligorovski; Barzaghi; Hoffmann; Lazarou; Vasiliev; Herrmann International Journal of Chemical Kinetics, 2008 , vol. 40, # 4 p. 174 - 188 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6,10,10-trimethyl-2-(4-methylphenyl)sulfonyloxy-bicyclo[7.2.0]undec-5-ene |
| 2,2,2-trifluoro-1-hydroxy-ethyl |