(4-bromophenyl)-[hydroperoxy(phenyl)methyl]diazene structure
|
Common Name | (4-bromophenyl)-[hydroperoxy(phenyl)methyl]diazene | ||
|---|---|---|---|---|
| CAS Number | 72437-42-4 | Molecular Weight | 307.14300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-bromophenyl)-[hydroperoxy(phenyl)methyl]diazene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11BrN2O2 |
|---|---|
| Molecular Weight | 307.14300 |
| Exact Mass | 306.00000 |
| PSA | 54.18000 |
| LogP | 4.72120 |
| InChIKey | JXBDZNGGQLDTRU-UHFFFAOYSA-N |
| SMILES | OOC(N=Nc1ccc(Br)cc1)c1ccccc1 |
|
~62%
(4-bromophenyl)... CAS#:72437-42-4 |
| Literature: Marusawa, Hiroshi; Ichikawa, Kazuhiko; Narita, Nozomu; Murakami, Hiromu; Ito, Keiichi; Tezuka, Takahiro Bioorganic and Medicinal Chemistry, 2002 , vol. 10, # 7 p. 2283 - 2290 |
|
~%
(4-bromophenyl)... CAS#:72437-42-4 |
| Literature: Marusawa, Hiroshi; Ichikawa, Kazuhiko; Narita, Nozomu; Murakami, Hiromu; Ito, Keiichi; Tezuka, Takahiro Bioorganic and Medicinal Chemistry, 2002 , vol. 10, # 7 p. 2283 - 2290 |
|
~%
(4-bromophenyl)... CAS#:72437-42-4 |
| Literature: Marusawa, Hiroshi; Ichikawa, Kazuhiko; Narita, Nozomu; Murakami, Hiromu; Ito, Keiichi; Tezuka, Takahiro Bioorganic and Medicinal Chemistry, 2002 , vol. 10, # 7 p. 2283 - 2290 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| PhCH(OOH)N=NC6H4Br-p |
| Hydroperoxide,[(4-bromophenyl)azo]phenylmethyl |
| [(4-bromophenyl)diazenyl](phenyl)methyl hydroperoxide |