Thiophene,2,3,4,5-tetrachloro-, 1,1-dioxide structure
|
Common Name | Thiophene,2,3,4,5-tetrachloro-, 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 72448-17-0 | Molecular Weight | 253.91900 | |
| Density | 1.97g/cm3 | Boiling Point | 218.2ºC at 760 mmHg | |
| Molecular Formula | C4Cl4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85.8ºC | |
| Name | 2,3,4,5-Tetrachlorothiophene 1,1-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.97g/cm3 |
|---|---|
| Boiling Point | 218.2ºC at 760 mmHg |
| Molecular Formula | C4Cl4O2S |
| Molecular Weight | 253.91900 |
| Flash Point | 85.8ºC |
| Exact Mass | 251.83700 |
| PSA | 42.52000 |
| LogP | 3.78900 |
| Index of Refraction | 1.625 |
| InChIKey | IEEFYTGFZKXEEU-UHFFFAOYSA-N |
| SMILES | O=S1(=O)C(Cl)=C(Cl)C(Cl)=C1Cl |
|
~97%
Thiophene,2,3,4... CAS#:72448-17-0 |
| Literature: Lou, Yan; Chang, Joanne; Jorgensen, Jeffrey; Lemal, David M. Journal of the American Chemical Society, 2002 , vol. 124, # 51 p. 15302 - 15307 |
|
~51%
Thiophene,2,3,4... CAS#:72448-17-0 |
| Literature: Raasch, Maynard S. Journal of Organic Chemistry, 1980 , vol. 45, # 5 p. 856 - 867 |
| 2,3,4,5-tetrachlorothiophene-S,S-dioxide |
| Tetrachlorothiophene S,S-dioxide |
| Thiophene,2,3,4,5-tetrachloro-,1,1-dioxide |
| 2,3,4,5-tetrachlorothiophene dioxide |
| Tetrachlorothiophene dioxide |
| 2,3,-DICARBOXYLIC ACID |
| 2,3,4,5-tetrachlorothiophene-1,1-dioxide |
| Tetrachlorothiophene 1,1-dioxide |
| Thiophene,2,3,4,5-tetrachloro-, 1,1-dioxide |