Butanamide,N-[4-[[4-(acetylamino)phenyl]sulfonyl]phenyl]- structure
|
Common Name | Butanamide,N-[4-[[4-(acetylamino)phenyl]sulfonyl]phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 7248-33-1 | Molecular Weight | 360.42700 | |
| Density | 1.301g/cm3 | Boiling Point | 663.6ºC at 760 mmHg | |
| Molecular Formula | C18H20N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 355.1ºC | |
| Name | N-[4-(4-acetamidophenyl)sulfonylphenyl]butanamide |
|---|
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 663.6ºC at 760 mmHg |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.42700 |
| Flash Point | 355.1ºC |
| Exact Mass | 360.11400 |
| PSA | 100.72000 |
| LogP | 4.44320 |
| Index of Refraction | 1.606 |
| InChIKey | PRSLULCCLBCMHL-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Nc1ccc(S(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
|
~%
Butanamide,N-[4... CAS#:7248-33-1 |
| Literature: Shonle; Van Arendonk Journal of the American Chemical Society, 1943 , vol. 65, p. 2375 |
|
~%
Butanamide,N-[4... CAS#:7248-33-1 |
| Literature: Shonle; Van Arendonk Journal of the American Chemical Society, 1943 , vol. 65, p. 2375 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |