6-chloro-N-(4-methylphenyl)pyrimidine-2,4-diamine structure
|
Common Name | 6-chloro-N-(4-methylphenyl)pyrimidine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 7249-31-2 | Molecular Weight | 234.68500 | |
| Density | 1.361g/cm3 | Boiling Point | 468.3ºC at 760 mmHg | |
| Molecular Formula | C11H11ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237ºC | |
| Name | 6-chloro-4-N-(4-methylphenyl)pyrimidine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 468.3ºC at 760 mmHg |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.68500 |
| Flash Point | 237ºC |
| Exact Mass | 234.06700 |
| PSA | 63.83000 |
| LogP | 3.41840 |
| Index of Refraction | 1.688 |
| InChIKey | KAUBSLPJWJEOKU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2cc(Cl)nc(N)n2)cc1 |
|
~24%
6-chloro-N-(4-m... CAS#:7249-31-2 |
| Literature: Aoyagi; Yanada; Bessho; Yoneda; Armarego Journal of Heterocyclic Chemistry, 1991 , vol. 28, # 6 p. 1537 - 1539 |
|
~%
6-chloro-N-(4-m... CAS#:7249-31-2 |
| Literature: Aoyagi; Yanada; Bessho; Yoneda; Armarego Journal of Heterocyclic Chemistry, 1991 , vol. 28, # 6 p. 1537 - 1539 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Amino-4-chloro-6-p-toluidinopyrimidine |
| 6-Chlor-N4-p-tolyl-pyrimidin-2,4-diyldiamin |
| 6-chloro-N4-p-tolyl-pyrimidine-2,4-diyldiamine |