6-chloro-N-(4-methoxyphenyl)pyrimidine-2,4-diamine structure
|
Common Name | 6-chloro-N-(4-methoxyphenyl)pyrimidine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 91241-38-2 | Molecular Weight | 250.68400 | |
| Density | 1.391g/cm3 | Boiling Point | 483.6ºC at 760 mmHg | |
| Molecular Formula | C11H11ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.3ºC | |
| Name | 1,3,5-Triazine-2,4-diamine,6-chloro-N2-cyclohexyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.391g/cm3 |
|---|---|
| Boiling Point | 483.6ºC at 760 mmHg |
| Molecular Formula | C11H11ClN4O |
| Molecular Weight | 250.68400 |
| Flash Point | 246.3ºC |
| Exact Mass | 250.06200 |
| PSA | 73.06000 |
| LogP | 3.11860 |
| Index of Refraction | 1.674 |
| InChIKey | BXMJFCPTYHVVNV-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2cc(Cl)nc(N)n2)cc1 |
|
~%
6-chloro-N-(4-m... CAS#:91241-38-2 |
| Literature: Basford et al. Journal of the Chemical Society, 1947 , p. 1354,1360 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-Chloro-N-cyclohexyl-1,3,5-triazine-2,4-diamine |