Eptazocine structure
|
Common Name | Eptazocine | ||
|---|---|---|---|---|
| CAS Number | 72522-13-5 | Molecular Weight | 231.33300 | |
| Density | 1.088g/cm3 | Boiling Point | 353.6ºC at 760 mmHg | |
| Molecular Formula | C15H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.3ºC | |
Use of EptazocineEptazocine (Sedapain) is a κ-opioid receptor agonist and μ-opioid receptor antagonist. Eptazocine has the effect of relieving pain[1]. |
| Name | eptazocine |
|---|
| Description | Eptazocine (Sedapain) is a κ-opioid receptor agonist and μ-opioid receptor antagonist. Eptazocine has the effect of relieving pain[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 353.6ºC at 760 mmHg |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.33300 |
| Flash Point | 166.3ºC |
| Exact Mass | 231.16200 |
| PSA | 23.47000 |
| LogP | 2.48570 |
| Index of Refraction | 1.569 |
| InChIKey | ZOWQTJXNFTWSCS-IAQYHMDHSA-N |
| SMILES | CN1CCC2(C)CC(Cc3ccc(O)cc32)C1 |