4-Imidazolidinone, 5-((4-methoxyphenyl)methylene)-2-thioxo structure
|
Common Name | 4-Imidazolidinone, 5-((4-methoxyphenyl)methylene)-2-thioxo | ||
|---|---|---|---|---|
| CAS Number | 7253-52-3 | Molecular Weight | 234.27400 | |
| Density | 1.37g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.37g/cm3 |
|---|---|
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.27400 |
| Exact Mass | 234.04600 |
| PSA | 82.45000 |
| LogP | 1.69800 |
| Index of Refraction | 1.672 |
| InChIKey | XNQUYEHNKGAJNI-TWGQIWQCSA-N |
| SMILES | COc1ccc(C=C2NC(=S)NC2=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-Imidazolidino... CAS#:7253-52-3 |
| Literature: Kiec-Kononowicz, Katarzyna; Karolak-Wojciechowska, Janina; Handzlik, Jadwiga Acta Poloniae Pharmaceutica - Drug Research, 1998 , vol. 55, # 5 p. 381 - 388 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one? |
| A: Polar surface area (PSA) of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one is 82.45000. |
| Q: What is the molecular formula of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one? |
| A: Molecular formula of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one is C11H10N2O2S. |
| Q: What are the upstream materials of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one? |
| A: Related upstream materials(CAS) of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one: 503-87-7;123-11-5. |
| Q: What is the molecular weight of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one? |
| A: Molecular weight of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one is 234.27400. |
| Q: What is the CAS number of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one? |
| A: CAS number of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one is 7253-52-3. |
| Q: What is the InChIKey of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one? |
| A: InChIKey of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one is XNQUYEHNKGAJNI-TWGQIWQCSA-N. |
| Q: What is the Chinese name of 7253-52-3? |
| A: Chinese name of 7253-52-3 is 7253-52-3. |
| Q: What is the SMILES notation of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one? |
| A: SMILES notation of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one is COc1ccc(C=C2NC(=S)NC2=O)cc1. |
| Q: What is the English name of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one? |
| A: The English name of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one is (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one. |
| Q: What is the LogP of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one? |
| A: LogP of (5Z)-5-[(4-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one is 1.69800. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |