(2-amino-6-oxo-7H-purin-3-yl) acetate structure
|
Common Name | (2-amino-6-oxo-7H-purin-3-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 72553-23-2 | Molecular Weight | 209.16200 | |
| Density | 1.89g/cm3 | Boiling Point | 546.4ºC at 760 mmHg | |
| Molecular Formula | C7H7N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.3ºC | |
| Name | (2-amino-6-oxo-7H-purin-3-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.89g/cm3 |
|---|---|
| Boiling Point | 546.4ºC at 760 mmHg |
| Molecular Formula | C7H7N5O3 |
| Molecular Weight | 209.16200 |
| Flash Point | 284.3ºC |
| Exact Mass | 209.05500 |
| PSA | 116.88000 |
| Index of Refraction | 1.812 |
| InChIKey | NLHBBFAETXJASX-UHFFFAOYSA-N |
| SMILES | CC(=O)On1c(N)nc(=O)c2[nH]cnc21 |
|
~%
(2-amino-6-oxo-... CAS#:72553-23-2 |
| Literature: Hashimoto, Yuichi; Shudo, Koichi; Okamoto, Toshihiko Journal of the American Chemical Society, 1982 , vol. 104, # 26 p. 7636 - 7640 |
|
~%
(2-amino-6-oxo-... CAS#:72553-23-2 |
| Literature: Hashimoto; Shudo; Okamoto Chemical and pharmaceutical bulletin, 1984 , vol. 32, # 11 p. 4300 - 4308 |
| Acetic acid,2-amino-6,9-dihydro-6-oxo-3H-purin-3-yl ester |
| 3-(acetyloxy)-2-amino-3,7-dihydro-6h-purin-6-one |
| 6H-Purin-6-one,3-(acetyloxy)-2-amino-3,7-dihydro-(9CI) |
| N3-acetoxyguanine |