3,4-dibromo-3,4-dimethyl-1-phenyl-1$l^C12H15Br2OP-phosphacyclopentane 1-oxide structure
|
Common Name | 3,4-dibromo-3,4-dimethyl-1-phenyl-1$l^C12H15Br2OP-phosphacyclopentane 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 72620-94-1 | Molecular Weight | 366.02900 | |
| Density | 1.63g/cm3 | Boiling Point | 442.7ºC at 760 mmHg | |
| Molecular Formula | C12H15Br2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.5ºC | |
| Name | 3,4-dibromo-3,4-dimethyl-1-phenyl-1λ5-phospholane 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 442.7ºC at 760 mmHg |
| Molecular Formula | C12H15Br2OP |
| Molecular Weight | 366.02900 |
| Flash Point | 221.5ºC |
| Exact Mass | 363.92300 |
| PSA | 26.88000 |
| LogP | 3.99580 |
| Index of Refraction | 1.583 |
| InChIKey | IAYBDUDPRHKBMT-UHFFFAOYSA-N |
| SMILES | CC1(Br)CP(=O)(c2ccccc2)CC1(C)Br |
|
~%
3,4-dibromo-3,4... CAS#:72620-94-1 |
| Literature: Hughes,A.N. et al. Journal of Heterocyclic Chemistry, 1979 , vol. 16, p. 1417 - 1422 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,4-dibromo-3,4-dimethyl-1-phenyl-phospholane 1-oxide |
| 3,4-dibromo-3,4-dimethyl-1-phenyl-1 |