3,4-dimethyl-1-phenyl-1$l^C12H15OP-phosphacyclopent-3-ene 1-oxide structure
|
Common Name | 3,4-dimethyl-1-phenyl-1$l^C12H15OP-phosphacyclopent-3-ene 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 710-89-4 | Molecular Weight | 206.22100 | |
| Density | 1.09g/cm3 | Boiling Point | 372.5ºC at 760 mmHg | |
| Molecular Formula | C12H15OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.1ºC | |
| Name | 3,4-dimethyl-1-phenyl-2,5-dihydro-1λ5-phosphole 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 372.5ºC at 760 mmHg |
| Molecular Formula | C12H15OP |
| Molecular Weight | 206.22100 |
| Flash Point | 179.1ºC |
| Exact Mass | 206.08600 |
| PSA | 26.88000 |
| LogP | 3.02500 |
| Index of Refraction | 1.533 |
| InChIKey | SYTSUHQXPQYJTF-UHFFFAOYSA-N |
| SMILES | CC1=C(C)CP(=O)(c2ccccc2)C1 |
|
~%
3,4-dimethyl-1-... CAS#:710-89-4 |
| Literature: Mathey,F. Tetrahedron, 1972 , vol. 28, p. 4171 - 4181 |
|
~90%
3,4-dimethyl-1-... CAS#:710-89-4 |
| Literature: Hammond, Philip J.; Scott, Graham; Hall, C. Dennis Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1982 , p. 205 - 210 |
|
~%
3,4-dimethyl-1-... CAS#:710-89-4 |
| Literature: Du Pont de Nemours and Co. Patent: US26633737 , 1951 ; |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| 3,4-dimethyl-1-phenyl-2,5-dihydrophosphole oxide |
| 3,4-dimethyl-1-phenyl-3-phospholene-1-oxide |
| 2,5-dihydro-3,4-dimethyl-1-phenyl-1H-phosphole 1-oxide |
| 3,4-Dimethyl-1-phenyl-2,5-dihydro-1H-phosphole 1-oxide |
| 3,4-dimethyl-1-phenyl-2,5-dihydro-1H-phosphol-1-oxide |
| 1-oxo-1-phenyl-3,4-dimethyl-3-phospholene |