4-Nitrophenyl 6-O-(a-D-mannopyranosyl)-a-D-mannopyranoside structure
|
Common Name | 4-Nitrophenyl 6-O-(a-D-mannopyranosyl)-a-D-mannopyranoside | ||
|---|---|---|---|---|
| CAS Number | 72647-96-2 | Molecular Weight | 463.39000 | |
| Density | 1.7g/cm3 | Boiling Point | 791.3ºC at 760 mmHg | |
| Molecular Formula | C18H25NO13 | Melting Point | 176-178ºC | |
| MSDS | N/A | Flash Point | 432.4ºC | |
| Name | 4-Nitrophenyl 6-O-(a-D-mannopyranosyl)-a-D-mannopyranoside |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 791.3ºC at 760 mmHg |
| Melting Point | 176-178ºC |
| Molecular Formula | C18H25NO13 |
| Molecular Weight | 463.39000 |
| Flash Point | 432.4ºC |
| Exact Mass | 463.13300 |
| PSA | 224.35000 |
| Index of Refraction | 1.67 |
| InChIKey | ISCYUJSLZREARS-LFVZYRDMSA-N |
| SMILES | O=[N+]([O-])c1ccc(OC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)cc1 |
|
~41%
4-Nitrophenyl 6... CAS#:72647-96-2 |
| Literature: Bioscience, Biotechnology and Biochemistry, , vol. 66, # 4 p. 928 - 933 |
|
~13%
Detail
|
| Literature: Carbohydrate Research, , vol. 217, # 1 p. 255 - 262 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Nitrophenyl trimethylacetate |
| p-Nitrophenyl pivalate |
| p-nitrophenyl trimethylacetate |
| pivalic acid-(4-nitro-phenyl ester) |
| 2,2-Dimethylpropanoic acid,4-nitrophenyl ester |
| Pivalinsaeure-(4-nitro-phenylester) |
| 4-nitrophenyl pivalate |