4-propylthiomorpholine
Modify Date: 2025-08-23 16:37:35
4-propylthiomorpholine structure
|
Common Name | 4-propylthiomorpholine | ||
|---|---|---|---|---|
| CAS Number | 72662-77-2 | Molecular Weight | 145.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H15NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-propylthiomorpholine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H15NS |
|---|---|
| Molecular Weight | 145.26600 |
| Exact Mass | 145.09300 |
| PSA | 28.54000 |
| LogP | 1.38310 |
|
~%
4-propylthiomor... CAS#:72662-77-2 |
| Literature: Lawson; Reid Journal of the American Chemical Society, 1925 , vol. 47, p. 2829 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Propyl-thiomorpholin |
| N-n-propylthiomorpholine |
| 4-propyl-thiomorpholine |
| N-(n-Propyl)-thiomorpholin |
| Thiomorpholine,4-propyl |