2,2'-methylenebis[4-sec-butyl-6-tert-butylphenol] structure
|
Common Name | 2,2'-methylenebis[4-sec-butyl-6-tert-butylphenol] | ||
|---|---|---|---|---|
| CAS Number | 72672-54-9 | Molecular Weight | 424.65800 | |
| Density | 0.982g/cm3 | Boiling Point | 479.4ºC at 760 mmHg | |
| Molecular Formula | C29H44O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.9ºC | |
| Name | 4-butan-2-yl-2-[(5-butan-2-yl-3-tert-butyl-2-hydroxyphenyl)methyl]-6-tert-butylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.982g/cm3 |
|---|---|
| Boiling Point | 479.4ºC at 760 mmHg |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.65800 |
| Flash Point | 188.9ºC |
| Exact Mass | 424.33400 |
| PSA | 40.46000 |
| LogP | 8.31060 |
| Index of Refraction | 1.531 |
| InChIKey | PAMOFRNFPOZAHQ-UHFFFAOYSA-N |
| SMILES | CCC(C)c1cc(Cc2cc(C(C)CC)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 2,2'-METHYLENEBIS[4-SEC-BUTYL-6-TERT-BUTYLPHENOL] |
| 2,2A'A inverted exclamation markA'A-methylenebis[4-sec-butyl-6-tert-butylphenol] |
| Phenol,2,2'-methylenebis(6-(1,1-dimethylethyl)-4-(1-methylpropyl) |
| EINECS 276-760-4 |