2,4(1H,3H)-Pyrimidinedione,6-(phenylamino) structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,6-(phenylamino) | ||
|---|---|---|---|---|
| CAS Number | 7269-15-0 | Molecular Weight | 203.19700 | |
| Density | 1.375g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-anilino-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.375g/cm3 |
|---|---|
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.19700 |
| Exact Mass | 203.06900 |
| PSA | 77.75000 |
| LogP | 0.87980 |
| Index of Refraction | 1.655 |
| InChIKey | XKWQUTFERHHKNT-UHFFFAOYSA-N |
| SMILES | O=c1cc(Nc2ccccc2)[nH]c(=O)[nH]1 |
|
Name: Inhibition of wild-type Bacillus subtilis DNA polymerase 3-mediated dGTP truncated DN...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3282983
|
| 6-phenylamino-1H-pyrimidine-2,4-dione |
| 6-anilinouracil |
| 4-Anilino-uracil |