Benzenesulfonic acid,4-amino-, 2-(2,2,2-trifluoro-1-methylethylidene)hydrazide
Modify Date: 2026-06-18 21:27:03
Benzenesulfonic acid,4-amino-, 2-(2,2,2-trifluoro-1-methylethylidene)hydrazide structure
|
Common Name | Benzenesulfonic acid,4-amino-, 2-(2,2,2-trifluoro-1-methylethylidene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 727-35-5 | Molecular Weight | 281.25500 | |
| Density | 1.48g/cm3 | Boiling Point | 355.2ºC at 760 mmHg | |
| Molecular Formula | C9H10F3N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.6ºC | |
| Name | 4-amino-N-(1,1,1-trifluoropropan-2-ylideneamino)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 355.2ºC at 760 mmHg |
| Molecular Formula | C9H10F3N3O2S |
| Molecular Weight | 281.25500 |
| Flash Point | 168.6ºC |
| Exact Mass | 281.04500 |
| PSA | 92.93000 |
| LogP | 3.53820 |
| Index of Refraction | 1.539 |
| InChIKey | OLHTVTPCXYJVMZ-UHFFFAOYSA-N |
| SMILES | CC(=NNS(=O)(=O)c1ccc(N)cc1)C(F)(F)F |
|
~%
Benzenesulfonic... CAS#:727-35-5 |
| Literature: Zimmer et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 1667,1668, 1673 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| methyl bis(4-methoxyphenyl)acetate |
| sulfanilic acid-(tetrahydropyran-2-ylmethyl-amide) |
| Sulfanilsaeure-(tetrahydropyran-2-ylmethyl-amid) |