Phenyl(2-(trifluoromethyl)phenyl)methanone structure
|
Common Name | Phenyl(2-(trifluoromethyl)phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 727-99-1 | Molecular Weight | 250.21600 | |
| Density | 1.6g/cm3 | Boiling Point | 369ºC at 760 mmHg | |
| Molecular Formula | C14H9F3O | Melting Point | 60-62 °C | |
| MSDS | Chinese USA | Flash Point | 177ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(Trifluoromethyl)benzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 369ºC at 760 mmHg |
| Melting Point | 60-62 °C |
| Molecular Formula | C14H9F3O |
| Molecular Weight | 250.21600 |
| Flash Point | 177ºC |
| Exact Mass | 250.06100 |
| PSA | 17.07000 |
| LogP | 3.93640 |
| Index of Refraction | 1.56 |
| InChIKey | JXIWJBWMQXDALU-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccccc1C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S37/39-S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Preparative synthesis of optically pure ortho-substituted benzhydrols by asymmetric reductions of the corresponding benzophenones. Brown E, et al.
Tetrahedron Asymmetry 3(7) , 841-44, (1992)
|
| EINECS 211-972-2 |
| 2-(trifluoromethyl)benzophenone |
| MFCD00000377 |