6,8-dichloro-3-cyanochromone
Modify Date: 2025-08-25 15:42:07
6,8-dichloro-3-cyanochromone structure
|
Common Name | 6,8-dichloro-3-cyanochromone | ||
|---|---|---|---|---|
| CAS Number | 72798-32-4 | Molecular Weight | 240.04200 | |
| Density | 1.6g/cm3 | Boiling Point | 425.9ºC at 760 mmHg | |
| Molecular Formula | C10H3Cl2NO2 | Melting Point | 169-174 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 211.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6,8-dichloro-4-oxochromene-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 425.9ºC at 760 mmHg |
| Melting Point | 169-174 °C(lit.) |
| Molecular Formula | C10H3Cl2NO2 |
| Molecular Weight | 240.04200 |
| Flash Point | 211.4ºC |
| Exact Mass | 238.95400 |
| PSA | 54.00000 |
| LogP | 2.97148 |
| Index of Refraction | 1.649 |
| InChIKey | YERQUFAYRCSXEQ-UHFFFAOYSA-N |
| SMILES | N#Cc1coc2c(Cl)cc(Cl)cc2c1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| 6,8-Dichloro-3-cyanochromone |
| 6,8-dichloro-4-oxo-4H-1-benzopyran-3-carbonitrile |
| 6,8-dichloro-4-oxo-4h-chromene-3-carbonitrile |
| MFCD00192004 |