Panaxydol structure
|
Common Name | Panaxydol | ||
|---|---|---|---|---|
| CAS Number | 72800-72-7 | Molecular Weight | 260.37100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PanaxydolPanaxydol is isolated from Panax ginseng roots. Panaxydol induces mitochondria-mediated apoptosis. Panaxydol has the potential to be an anticancer agent, especially for EGFR-addicted cancer[1]. |
| Name | (3R,9R,10S)-panaxydol |
|---|---|
| Synonym | More Synonyms |
| Description | Panaxydol is isolated from Panax ginseng roots. Panaxydol induces mitochondria-mediated apoptosis. Panaxydol has the potential to be an anticancer agent, especially for EGFR-addicted cancer[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: apoptosis[1] |
| References |
| Molecular Formula | C17H24O2 |
|---|---|
| Molecular Weight | 260.37100 |
| Exact Mass | 260.17800 |
| PSA | 32.76000 |
| LogP | 3.05810 |
| InChIKey | GVLDSGIQZAFIAN-IXDOHACOSA-N |
| SMILES | C=CC(O)C#CC#CCC1OC1CCCCCCC |
|
~%
Panaxydol CAS#:72800-72-7 |
| Literature: Yadav; Maiti, Arup Tetrahedron, 2002 , vol. 58, # 24 p. 4955 - 4961 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| panaxydol |