null
null structure
|
Common Name | null | ||
|---|---|---|---|---|
| CAS Number | 7286-69-3 | Molecular Weight | 229.71000 | |
| Density | 1.232g/cm3 | Boiling Point | 380ºC at 760 mmHg | |
| Molecular Formula | C9H16ClN5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | sebuthylazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 380ºC at 760 mmHg |
| Molecular Formula | C9H16ClN5 |
| Molecular Weight | 229.71000 |
| Flash Point | 2ºC |
| Exact Mass | 229.10900 |
| PSA | 62.73000 |
| LogP | 2.31320 |
| Index of Refraction | 1.592 |
| InChIKey | BZRUVKZGXNSXMB-UHFFFAOYSA-N |
| SMILES | CCNc1nc(Cl)nc(NC(C)CC)n1 |
| Storage condition | APPROX 4°C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | F,Xn |
| Risk Phrases | 11-20/21/22-36 |
| Safety Phrases | 16-26-36 |
| RIDADR | UN 1648 3/PG 2 |
| RTECS | XY4520000 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00145272 |
| 6-chloro-N-ethyl-N’-(1-methylpropyl)-1,3,5-triazine-2,4-diamine |
| Sebuthylazine |
| sebutylazine |
| (RS)-N2-sec-butyl-6-chloro-N4-ethyl-1,3,5-triazine-2,4-diamine |
| 2-N-butan-2-yl-6-chloro-4-N-ethyl-1,3,5-triazine-2,4-diamine |
| s-Triazine,2-(sec-butylamino)-4-chloro-6-(ethylamino) |
| rac-N2-[(2R)-butan-2-yl]-6-chloro-N4-ethyl-1,3,5-triazine-2,4-diamine |
| Sebuthylazin |
| 1,3,5-Triazine-2,4-diamine,6-chloro-N-ethyl-N'-(1-methylpropyl) |
| EINECS 230-710-8 |
| sec-buthylazine |
| N-sec-butyl-6-chloro-N'-ethyl-[1,3,5]triazine-2,4-diamine |
| secbutylazine |
| Sebuthylazine [ISO] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of sebuthylazine? |
| A: LogP of sebuthylazine is 2.31320. |
| Q: What are the storage conditions for sebuthylazine? |
| A: Storage conditions for sebuthylazine: APPROX 4°C. |
| Q: What is the InChIKey of sebuthylazine? |
| A: InChIKey of sebuthylazine is BZRUVKZGXNSXMB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of sebuthylazine? |
| A: SMILES notation of sebuthylazine is CCNc1nc(Cl)nc(NC(C)CC)n1. |
| Q: What is the molecular weight of sebuthylazine? |
| A: Molecular weight of sebuthylazine is 229.71000. |
| Q: What is the English name of sebuthylazine? |
| A: The English name of sebuthylazine is sebuthylazine. |
| Q: What is the CAS number of sebuthylazine? |
| A: CAS number of sebuthylazine is 7286-69-3. |
| Q: What is the polar surface area (PSA) of sebuthylazine? |
| A: Polar surface area (PSA) of sebuthylazine is 62.73000. |
| Q: What is the safety information for sebuthylazine? |
| A: Safety information for sebuthylazine: 16-26-36. |
| Q: What is the boiling point of sebuthylazine? |
| A: Boiling point of sebuthylazine is 380ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |