1,4-Cyclohexanedicarboxylicacid, 1,4-diethyl ester structure
|
Common Name | 1,4-Cyclohexanedicarboxylicacid, 1,4-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 72903-27-6 | Molecular Weight | 228.285 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 285.8±15.0 °C at 760 mmHg | |
| Molecular Formula | C12H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.5±18.8 °C | |
| Name | diethyl cyclohexane-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 285.8±15.0 °C at 760 mmHg |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.285 |
| Flash Point | 132.5±18.8 °C |
| Exact Mass | 228.136154 |
| PSA | 52.60000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.460 |
| InChIKey | KRJHRNUTLDTSKY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC(C(=O)OCC)CC1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917209090 |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 1,4-Cyclohexandicarbonsure,Diethylester |
| 1,4-Cyclohexanedicarboxylic acid, diethyl ester |
| cyclohexane-1,4-dicarboxylic acid diethyl ester |
| 1,4-cyclohexanedicarboxylicacid,diethylester |
| Cyclohexan-1,4-dicarbonsaeurediaethylester |
| Diethyl 1,4-cyclohexanedicarboxylate |
| Diethyl cyclohexane-1,4-dicarboxylate |