1,4,6-triphenylpyrimidin-2-one structure
|
Common Name | 1,4,6-triphenylpyrimidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 72923-16-1 | Molecular Weight | 324.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4,6-triphenylpyrimidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H16N2O |
|---|---|
| Molecular Weight | 324.37500 |
| Exact Mass | 324.12600 |
| PSA | 34.89000 |
| LogP | 4.56650 |
| InChIKey | KZDTXLGZDTZKLI-UHFFFAOYSA-N |
| SMILES | O=c1nc(-c2ccccc2)cc(-c2ccccc2)n1-c1ccccc1 |
|
~80%
1,4,6-triphenyl... CAS#:72923-16-1 |
| Literature: Nishio, Takehiko; Omote, Yoshimori Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , p. 239 - 242 |
|
~%
1,4,6-triphenyl... CAS#:72923-16-1 |
| Literature: Nishio, Takehiko; Omote, Yoshimori Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , p. 239 - 242 |
| 2(1H)-Pyrimidinone,1,4,6-triphenyl |
| 1,4,6-triphenyl-2(1H)-pyrimidin-2-one |
| 1,4,6-triphenylpyrimidin-2(1H)-one |
| 1,4,6-triphenyl-1H-pyrimidin-2-one |
| 1,4,6-triphenyl-2(1H)-pyrimidinone |