4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one
4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one structure
|
Common Name | 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 73097-75-3 | Molecular Weight | 230.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14N2O2 |
|---|---|
| Molecular Weight | 230.26200 |
| Exact Mass | 230.10600 |
| PSA | 49.74000 |
| LogP | 1.42330 |
| InChIKey | XXZYWPLODMDGEW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1C(=O)N(c2ccc(C)cc2)N=C1C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~83%
4-acetyl-5-meth... CAS#:73097-75-3 |
| Literature: Rana, Arjunsinh; Parekh, Nayan; Dabhi, Harish; Bhoi, Dipak; Kumari, Niraj E-Journal of Chemistry, 2011 , vol. 8, # 4 p. 1820 - 1831 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3H-Pyrazol-3-one,4-acetyl-2,4-dihydro-5-methyl-2-(4-methylphenyl) |
| 4-acetyl-3-methyl-1-(4-methylphenyl)-2-pyrazolin-5-one |
| 4-acetyl-1-(4-methylphenyl)-3-methyl-2-pyrazolin-5-one |
| 3-methyl-1-(4'-methylphenyl)-4-acetyl-2-pyrazolin-5-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one? |
| A: InChIKey of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one is XXZYWPLODMDGEW-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one? |
| A: CAS number of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one is 73097-75-3. |
| Q: What is the molecular formula of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one? |
| A: Molecular formula of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one is C13H14N2O2. |
| Q: What is the polar surface area (PSA) of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one? |
| A: Polar surface area (PSA) of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one is 49.74000. |
| Q: What is the English name of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one? |
| A: The English name of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one is 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one. |
| Q: What is the molecular weight of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one? |
| A: Molecular weight of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one is 230.26200. |
| Q: What is the SMILES notation of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one? |
| A: SMILES notation of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one is CC(=O)C1C(=O)N(c2ccc(C)cc2)N=C1C. |
| Q: What are the upstream materials of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one? |
| A: Related upstream materials(CAS) of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one: 75-36-5;86-92-0. |
| Q: What is the Chinese name of 73097-75-3? |
| A: Chinese name of 73097-75-3 is 73097-75-3. |
| Q: What is the LogP of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one? |
| A: LogP of 4-acetyl-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one is 1.42330. |