dichloro-N-[(dimethylamino)sulphonyl]fluoro-N-(p-tolyl)methanesulphenamide structure
|
Common Name | dichloro-N-[(dimethylamino)sulphonyl]fluoro-N-(p-tolyl)methanesulphenamide | ||
|---|---|---|---|---|
| CAS Number | 731-27-1 | Molecular Weight | 347.25700 | |
| Density | 1.505g/cm3 | Boiling Point | 366ºC at 760 mmHg | |
| Molecular Formula | C10H13Cl2FN2O2S2 | Melting Point | 96°C | |
| MSDS | Chinese USA | Flash Point | 175.1ºC | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | tolylfluanid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.505g/cm3 |
|---|---|
| Boiling Point | 366ºC at 760 mmHg |
| Melting Point | 96°C |
| Molecular Formula | C10H13Cl2FN2O2S2 |
| Molecular Weight | 347.25700 |
| Flash Point | 175.1ºC |
| Exact Mass | 345.97800 |
| PSA | 74.30000 |
| LogP | 4.39520 |
| Index of Refraction | 1.606 |
| InChIKey | HYVWIQDYBVKITD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(SC(F)(Cl)Cl)S(=O)(=O)N(C)C)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H317-H319-H330-H335-H372-H400 |
| Precautionary Statements | P260-P273-P280-P284-P305 + P351 + P338-P310 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Phrases | 23-36/37/38-43-48/20-50/53 |
| Safety Phrases | S24;S26;S37;S38;S45;S60;S61 |
| RIDADR | UN 2588 |
| RTECS | WO6560000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
|
Baby food production chain: pesticide residues in fresh apples and products.
Food Addit. Contam. 22(12) , 1231-42, (2005) During 3 years of a monitoring programme, 522 samples of fresh apples, six brands of fruit purées and various types of fruit baby food prepared from these materials were analysed. Each sample was exam... |
|
|
[Occurrence of pesticide residues in raspberries in 2000-2005].
Rocz. Panstw. Zakl. Hig. 58(3) , 509-13, (2007) The aim of this paper was to present occurrence of pesticide residues in raspberries in 2000-2005. Gas chromatographic and spectroscopy methods were used. The most frequently found were tolylfluanid r... |
|
|
Exposure to fungicides in fruit growing: re-entry time as a predictor for dermal exposure.
Am. Ind. Hyg. Assoc. J. 60(6) , 789-93, (1999) As part of a European Concerted Action on Male Reproduction Capability an exposure assessment survey was conducted among seasonal workers in the fruit growing sector in the Netherlands. Dermal exposur... |
| Tolyfluanide |
| Tolylfluanide [ISO-French] |
| tolilfluanide |
| Dichlofluanid-methyl |
| TOLYLFLUANID |
| Tolylfluanide |
| N-(dichloro-fluoromethylthio)-N',N'-dimethyl-N-p-tolylsulfamide |
| N-[dichloro(fluoro)methyl]sulfanyl-N-(dimethylsulfamoyl)-4-methylaniline |
| 1,1-dichloro-N-[(dimethylamino)sulfonyl]-1-fluoro-N-(4-methylphenyl)methanesulfenamide |
| MFCD00055477 |
| N-dichlorofluoromethylthio-N’,N’-dimethyl-N-p-tolylsulfamide |
| Euparen M |
| N-{[dichloro(fluoro)methyl]sulfanyl}-N’,N’-dimethyl-N-(4-methylphenyl)sulfuric diamide |
| Tolylfluanid [BSI:ISO] |
| Bayer 5712a |
| Tolyfluanid |
| EINECS 211-986-9 |