methyl 3-methyl-1H-indene-2-carboxylate
methyl 3-methyl-1H-indene-2-carboxylate structure
|
Common Name | methyl 3-methyl-1H-indene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 7316-64-5 | Molecular Weight | 188.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3-methyl-1H-indene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12O2 |
|---|---|
| Molecular Weight | 188.22200 |
| Exact Mass | 188.08400 |
| PSA | 26.30000 |
| LogP | 2.18920 |
| InChIKey | VAFIJZGHDGTWFN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)c2ccccc2C1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 3 | |
CAS#:34225-81-5
CAS#:74-88-4
CAS#:292638-85-8
CAS#:98-86-2
CAS#:3666-82-8
CAS#:18107-18-1
CAS#:2142-70-3
CAS#:119854-52-3
CAS#:1749-19-5
CAS#:87802-09-3
CAS#:87802-17-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-methoxycarbonyl-3-methyl-1H-indene |
| 3-methyl-1H-indene-2-carboxylic acid methyl ester |
| 3-Methyl-inden-2-carbonsaeure-methylester |
| 1-Methyl-2-inden-(1)-carbonsaeure-methylester |
| methyl 3-methyl-1H-2-indenecarboxylate |
| 3-methyl-indene-2-carboxylic acid methyl ester |
| 1H-Indene-2-carboxylic acid,3-methyl-,methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of methyl 3-methyl-1H-indene-2-carboxylate? |
| A: LogP of methyl 3-methyl-1H-indene-2-carboxylate is 2.18920. |
| Q: What is the molecular formula of methyl 3-methyl-1H-indene-2-carboxylate? |
| A: Molecular formula of methyl 3-methyl-1H-indene-2-carboxylate is C12H12O2. |
| Q: What are the upstream materials of methyl 3-methyl-1H-indene-2-carboxylate? |
| A: Related upstream materials(CAS) of methyl 3-methyl-1H-indene-2-carboxylate: 34225-81-5;74-88-4;292638-85-8;98-86-2;3666-82-8;18107-18-1;2142-70-3;119854-52-3;1749-19-5. |
| Q: What is the SMILES notation of methyl 3-methyl-1H-indene-2-carboxylate? |
| A: SMILES notation of methyl 3-methyl-1H-indene-2-carboxylate is COC(=O)C1=C(C)c2ccccc2C1. |
| Q: What English synonyms does methyl 3-methyl-1H-indene-2-carboxylate have? |
| A: English synonyms of methyl 3-methyl-1H-indene-2-carboxylate: 2-methoxycarbonyl-3-methyl-1H-indene, 3-methyl-1H-indene-2-carboxylic acid methyl ester, 3-Methyl-inden-2-carbonsaeure-methylester, 1-Methyl-2-inden-(1)-carbonsaeure-methylester, methyl 3-methyl-1H-2-indenecarboxylate, 3-methyl-indene-2-carboxylic acid methyl ester, 1H-Indene-2-carboxylic acid,3-methyl-,methyl ester. |
| Q: What is the InChIKey of methyl 3-methyl-1H-indene-2-carboxylate? |
| A: InChIKey of methyl 3-methyl-1H-indene-2-carboxylate is VAFIJZGHDGTWFN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 7316-64-5? |
| A: Chinese name of 7316-64-5 is 7316-64-5. |
| Q: What are the downstream products of methyl 3-methyl-1H-indene-2-carboxylate? |
| A: Related downstream products(CAS) of methyl 3-methyl-1H-indene-2-carboxylate: 34225-81-5;87802-09-3;87802-17-3. |
| Q: What is the polar surface area (PSA) of methyl 3-methyl-1H-indene-2-carboxylate? |
| A: Polar surface area (PSA) of methyl 3-methyl-1H-indene-2-carboxylate is 26.30000. |
| Q: What is the English name of methyl 3-methyl-1H-indene-2-carboxylate? |
| A: The English name of methyl 3-methyl-1H-indene-2-carboxylate is methyl 3-methyl-1H-indene-2-carboxylate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |