4-[3-(1,3-dioxoisoindol-2-yl)propoxy]benzaldehyde structure
|
Common Name | 4-[3-(1,3-dioxoisoindol-2-yl)propoxy]benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 73279-02-4 | Molecular Weight | 309.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[3-(1,3-dioxoisoindol-2-yl)propoxy]benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H15NO4 |
|---|---|
| Molecular Weight | 309.31600 |
| Exact Mass | 309.10000 |
| PSA | 63.68000 |
| LogP | 2.50210 |
| InChIKey | WACIDFSJZAPASS-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(OCCCN2C(=O)c3ccccc3C2=O)cc1 |
|
~88%
4-[3-(1,3-dioxo... CAS#:73279-02-4 |
| Literature: Manka; Lawrence Journal of the American Chemical Society, 1990 , vol. 112, # 6 p. 2440 - 2442 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzaldehyde,4-[3-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)propoxy] |
| 4-(3-phthalimidopropoxy)benzaldehyde |
| 4-(3-(1,3-dioxoisoindolin-2-yl)propoxy)benzaldehyde |
| 4-(3-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)propoxy)-benzaldehyde |
| 4-[3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propoxy]benzaldehyde |
| 2-[3-[4-Formylphenoxy]propyl]-1H-isoindole-1,3-dione |